CAS:42858-60-6|3,5-Dioxocyclohexanecarboxylic Acid
Molecular Formula:C7H8O4
Molecular Weight:156.14 g/mol
Purity:97 percent
Package:10g/25g/50g/100g/bulk package
- Kunsinna mad-dinja kollha
- Assigurazzjoni tal-Kwalità
- Servizz tal-Klijent 24/7
Introduzzjoni tal-Prodott
3,5-Dioxocyclohexanecarboxylic acid(CAS:42858-60-6) is used in a variety of scientific research applications, including metabolic studies, drug development, and enzyme activity assays. It is also used as a reagent in the synthesis of other compounds, such as esters and amides. Oxalacetic acid has been used to study the metabolism of fatty acids, carbohydrates, and proteins, as well as the regulation of hormones. In addition, it has been used to study the effects of drugs on the body, such as the metabolism of drugs and their interactions with other compounds.
|
|
|
| 3,5-dioxocyclohexane-1-carboxylic acid | |
| MFCD09836162 | |
| 401.509ºC at 760 mmHg | |
| 1.398 g/cm3 | |
| 71.44 | |
| 0.01 | |
| 1.521 | |
| Sealed in dry,2-8 degree | |
| InChI=1S/C7H8O4/c8-5-1-4(7(10)11)2-6(9)3-5/h4H,1-3H2,(H,10,11) | |
| MCGPFJGIBKPQGO-UHFFFAOYSA-N |
It-tags Popolari: cas:42858-60-6|3,5-dioxocyclohexanecarboxylic acid, price, quotation, discount, in stock, for sale
![CAS 150728-12-4|5-(2-Methoxyphenoxy)-[2,2'-bipyrimidine]-4,6(1H,5H)-dione](/uploads/202235855/small/cas-150728-12-4-5-2-methoxyphenoxy-2-201400599793.png?size=384x0)
![CAS 459168-41-3 1-[(5-Kloro-1H-indol-2-il)karbonil]-4-metil-piperażin](/uploads/202235855/small/cas-459168-41-3-1-5-chloro-1h-indol-2-yl18227242517.jpg?size=384x0)
![CAS:86499-96-9|3-Bromo-2,3,4,5-tetrahydro-2H-benzo[b]azepin-2-one](/uploads/202235855/small/cas-86499-96-9-3-bromo-2-3-4-5-tetrahydro-2h05327678220.jpg?size=384x0)
